4-Bromo-3-nitrobenzoic acid
Catalog No: FT-0601656
CAS No: 6319-40-0
- Chemical Name: 4-Bromo-3-nitrobenzoic acid
- Molecular Formula: C7H4BrNO4
- Molecular Weight: 246.01
- InChI Key: RVCTZJVBWNFYRU-UHFFFAOYSA-N
- InChI: InChI=1S/C7H4BrNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 6319-40-0 |
| Flash_Point: | 160.0±25.1 °C |
| Product_Name: | 4-Bromo-3-nitrobenzoic acid |
| Bolling_Point: | 340.9±32.0 °C at 760 mmHg |
| FW: | 246.015 |
| Melting_Point: | 202-204ºC |
| MF: | C7H4BrNO4 |
| Density: | 1.9±0.1 g/cm3 |
| Melting_Point: | 202-204ºC |
|---|---|
| Refractive_Index: | 1.650 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C7H4BrNO4 |
| Flash_Point: | 160.0±25.1 °C |
| LogP: | 2.59 |
| FW: | 246.015 |
| Density: | 1.9±0.1 g/cm3 |
| PSA: | 83.12000 |
| Bolling_Point: | 340.9±32.0 °C at 760 mmHg |
| Exact_Mass: | 244.932358 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)