4-Hydroxy-2-oxopyrrolidine-N-acetamide
Catalog No: FT-0630731
CAS No: 62613-82-5
- Chemical Name: 4-Hydroxy-2-oxopyrrolidine-N-acetamide
- Molecular Formula: C6H10N2O3
- Molecular Weight: 158.16
- InChI Key: IHLAQQPQKRMGSS-UHFFFAOYSA-N
- InChI: InChI=1S/C6H10N2O3/c7-5(10)3-8-2-4(9)1-6(8)11/h4,9H,1-3H2,(H2,7,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 62613-82-5 |
| Flash_Point: | 252.9±27.3 °C |
| Product_Name: | Oxiracetam |
| Bolling_Point: | 494.6±40.0 °C at 760 mmHg |
| FW: | 158.155 |
| Melting_Point: | 165-168ºC |
| MF: | C6H10N2O3 |
| Density: | 1.4±0.1 g/cm3 |
| Melting_Point: | 165-168ºC |
|---|---|
| Refractive_Index: | 1.570 |
| Vapor_Pressure: | 0.0±2.9 mmHg at 25°C |
| MF: | C6H10N2O3 |
| Flash_Point: | 252.9±27.3 °C |
| LogP: | -2.48 |
| FW: | 158.155 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 83.63000 |
| Bolling_Point: | 494.6±40.0 °C at 760 mmHg |
| Exact_Mass: | 158.069138 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/38 |
| HS_Code: | 2933790090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | UX9656638 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)