D-DOPA
Catalog No: FT-0650636
CAS No: 5796-17-8
- Chemical Name: D-DOPA
- Molecular Formula: C9H11NO4
- Molecular Weight: 197.19
- InChI Key: WTDRDQBEARUVNC-UHFFFAOYSA-N
- InChI: InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 276-278ºC(lit.) |
|---|---|
| CAS: | 5796-17-8 |
| MF: | C9H11NO4 |
| Flash_Point: | 225.0±28.7 °C |
| Product_Name: | D-dopa |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 197.188 |
| Bolling_Point: | 448.4±45.0 °C at 760 mmHg |
| Refractive_Index: | 1.655 |
|---|---|
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Flash_Point: | 225.0±28.7 °C |
| LogP: | -0.22 |
| Bolling_Point: | 448.4±45.0 °C at 760 mmHg |
| FW: | 197.188 |
| PSA: | 103.78000 |
| Melting_Point: | 276-278ºC(lit.) |
| MF: | C9H11NO4 |
| Exact_Mass: | 197.068802 |
| Density: | 1.5±0.1 g/cm3 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| HS_Code: | 2922509090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)