2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
Catalog No: FT-0657335
CAS No: 53857-59-3
- Chemical Name: 2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE
- Molecular Formula: C4H4Br2N2
- Molecular Weight: 239.9
- InChI Key: WVCRXJDDBGDCTA-UHFFFAOYSA-N
- InChI: InChI=1S/C4H4Br2N2/c1-8-3(5)2-7-4(8)6/h2H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 302.3ºC at 760mmHg |
|---|---|
| CAS: | 53857-59-3 |
| MF: | C4H4Br2N2 |
| Melting_Point: | 68-72ºC |
| Symbol: | Danger |
| Density: | 2.22g/cm3 |
| FW: | 239.89600 |
| Product_Name: | 2,5-Dibromo-1-methyl-1H-imidazole |
| Flash_Point: | 136.6ºC |
| Exact_Mass: | 237.87400 |
|---|---|
| MF: | C4H4Br2N2 |
| Density: | 2.22g/cm3 |
| FW: | 239.89600 |
| Refractive_Index: | 1.671 |
| Bolling_Point: | 302.3ºC at 760mmHg |
| PSA: | 17.82000 |
| LogP: | 1.94510 |
| Flash_Point: | 136.6ºC |
| Melting_Point: | 68-72ºC |
| Symbol: | Danger |
|---|---|
| HS_Code: | 2933290090 |
| Safety_Statements: | 26-36/37/39 |
| Hazard_Codes: | Xi |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)