Ethyl L-tyrosinate hydrochloride
Catalog No: FT-0628040
CAS No: 4089-07-0
- Chemical Name: Ethyl L-tyrosinate hydrochloride
- Molecular Formula: C11H16ClNO3
- Molecular Weight: 245.70
- InChI Key: BQULAXAVRFIAHN-PPHPATTJSA-N
- InChI: InChI=1S/C11H15NO3.ClH/c1-2-15-11(14)10(12)7-8-3-5-9(13)6-4-8;/h3-6,10,13H,2,7,12H2,1H3;1H/t10-;/m0./s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 166-170 °C |
|---|---|
| CAS: | 4089-07-0 |
| MF: | C11H16ClNO3 |
| Flash_Point: | 161.4ºC |
| Product_Name: | H-Tyr-OEt·HCl |
| Density: | 1.177 g/cm3 |
| FW: | 245.703 |
| Bolling_Point: | 343.3ºC at 760 mmHg |
| Refractive_Index: | -6.5 ° (C=2, H2O) |
|---|---|
| Flash_Point: | 161.4ºC |
| LogP: | 2.32740 |
| Bolling_Point: | 343.3ºC at 760 mmHg |
| FW: | 245.703 |
| PSA: | 72.55000 |
| Melting_Point: | 166-170 °C |
| MF: | C11H16ClNO3 |
| Exact_Mass: | 245.081863 |
| Density: | 1.177 g/cm3 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| WGK_Germany: | 2 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RTECS: | YP2580000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2922509090 |
| Safety_Statements: | S22-S24/25 |
| Packing_Group: | III |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)