Roflumilast
Catalog No: FT-0660846
CAS No: 162401-32-3
- Chemical Name: Roflumilast
- Molecular Formula: C17H14Cl2F2N2O3
- Molecular Weight: 403.2
- InChI Key: MNDBXUUTURYVHR-UHFFFAOYSA-N
- InChI: InChI=1S/C17H14Cl2F2N2O3/c18-11-6-22-7-12(19)15(11)23-16(24)10-3-4-13(26-17(20)21)14(5-10)25-8-9-1-2-9/h3-7,9,17H,1-2,8H2,(H,22,23,24)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 403.207 |
|---|---|
| CAS: | 162401-32-3 |
| Flash_Point: | 214.2±28.7 °C |
| MF: | C17H14Cl2F2N2O3 |
| Symbol: | Warning |
| Bolling_Point: | 430.6±45.0 °C at 760 mmHg |
| Melting_Point: | N/A |
| Product_Name: | Roflumilast |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 403.207 |
|---|---|
| MF: | C17H14Cl2F2N2O3 |
| Exact_Mass: | 402.034943 |
| Bolling_Point: | 430.6±45.0 °C at 760 mmHg |
| Refractive_Index: | 1.604 |
| PSA: | 60.45000 |
| LogP: | 4.84 |
| Flash_Point: | 214.2±28.7 °C |
| Density: | 1.5±0.1 g/cm3 |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Symbol: | Warning |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H315-H319-H335 |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)