H-ARG-NH2 2HCL
Catalog No: FT-0656257
CAS No: 14975-30-5
- Chemical Name: H-ARG-NH2 2HCL
- Molecular Formula: C6H17Cl2N5O
- Molecular Weight: 246.14
- InChI Key: LYMQLFYWIDCFLC-FHNDMYTFSA-N
- InChI: InChI=1S/C6H15N5O.2ClH/c7-4(5(8)12)2-1-3-11-6(9)10;;/h4H,1-3,7H2,(H2,8,12)(H4,9,10,11);2*1H/t4-;;/m0../s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 246.138 |
| Density: | 1.46g/cm3 |
| CAS: | 14975-30-5 |
| Bolling_Point: | 446.4ºC at 760 mmHg |
| Product_Name: | H-Arg-NH2.2HCl |
| Melting_Point: | N/A |
| Flash_Point: | 223.8ºC |
| MF: | C6H17Cl2N5O |
| Density: | 1.46g/cm3 |
|---|---|
| LogP: | 2.25780 |
| Flash_Point: | 223.8ºC |
| Refractive_Index: | 1.624 |
| FW: | 246.138 |
| PSA: | 131.01000 |
| MF: | C6H17Cl2N5O |
| Bolling_Point: | 446.4ºC at 760 mmHg |
| Vapor_Pressure: | 3.66E-08mmHg at 25°C |
| Exact_Mass: | 245.081009 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
|---|---|
| Hazard_Codes: | T: Toxic; |
| Risk_Statements(EU): | R20/21/22 |
| Safety_Statements: | H302-H370 |
| Symbol: | Danger |
| Warning_Statement: | P260-P307 + P311 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2925290090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)