1,1',6,6',7,7'-Hexahydroxy-5,5'-diisopropyl-3,3'-dimethyl-2,2'-binaphthalene-8,8'-dicarbaldehyde
Catalog No: FT-0686636
CAS No: 12542-36-8
- Chemical Name: 1,1',6,6',7,7'-Hexahydroxy-5,5'-diisopropyl-3,3'-dimethyl-2,2'-binaphthalene-8,8'-dicarbaldehyde
- Molecular Formula: C32H34O10
- Molecular Weight: 578.6
- InChI Key: NIOHNDKHQHVLKA-UHFFFAOYSA-N
- InChI: InChI=1S/C30H30O8.C2H4O2/c1-11(2)19-15-7-13(5)21(27(35)23(15)17(9-31)25(33)29(19)37)22-14(6)8-16-20(12(3)4)30(38)26(34)18(10-32)24(16)28(22)36;1-2(3)4/h7-12,33-38H,1-6H3;1H3,(H,3,4)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07, GHS08 |
|---|---|
| CAS: | 12542-36-8 |
| Flash_Point: | 395.9ºC |
| Product_Name: | Gossypol (acetic acid) |
| Bolling_Point: | 707.9ºC at 760 mmHg |
| FW: | 578.606 |
| Melting_Point: | 164-168ºC |
| MF: | C32H34O10 |
| Density: | N/A |
| Melting_Point: | 164-168ºC |
|---|---|
| Vapor_Pressure: | 1.05E-20mmHg at 25°C |
| MF: | C32H34O10 |
| Flash_Point: | 395.9ºC |
| LogP: | 6.47310 |
| Bolling_Point: | 707.9ºC at 760 mmHg |
| FW: | 578.606 |
| PSA: | 192.82000 |
| Exact_Mass: | 578.215210 |
| Symbol: | GHS07, GHS08 |
|---|---|
| Risk_Statements(EU): | R22;R40 |
| HS_Code: | 2942000000 |
| Personal_Protective_Equipment: | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | MD7360000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
| Warning_Statement: | P281 |
| Safety_Statements: | H302-H351 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)