N,N-Dimethylethylamine
Catalog No: FT-0600045
CAS No: 598-56-1
- Chemical Name: N,N-Dimethylethylamine
- Molecular Formula: C4H11N
- Molecular Weight: 73.14
- InChI Key: DAZXVJBJRMWXJP-UHFFFAOYSA-N
- InChI: InChI=1S/C4H11N/c1-4-5(2)3/h4H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 73.137 |
| Density: | 0.7±0.1 g/cm3 |
| CAS: | 598-56-1 |
| Bolling_Point: | 36.3±3.0 °C at 760 mmHg |
| Product_Name: | DMEA |
| Melting_Point: | −140 °C(lit.) |
| Flash_Point: | -36.1±0.0 °C |
| MF: | C4H11N |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 2430 ', '2 . Molar volume (m3/mol)1018 ', '3 . Parachor (902K)2169 ', '4 . Surface tension 206 ', '5 . Polarizability 963'] |
|---|---|
| LogP: | 0.59 |
| Flash_Point: | -36.1±0.0 °C |
| Refractive_Index: | 1.393 |
| FW: | 73.137 |
| Density: | 0.7±0.1 g/cm3 |
| Bolling_Point: | 36.3±3.0 °C at 760 mmHg |
| Melting_Point: | −140 °C(lit.) |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 32 ', '7. Heavy Atom Count :5 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :176 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Water_Solubility: | SOLUBLE |
| PSA: | 3.24000 |
| MF: | C4H11N |
| More_Info: | ['1. Boiling point36℃。2. Melting point-140℃。'] |
| Vapor_Pressure: | 495.4±0.1 mmHg at 25°C |
| Exact_Mass: | 73.089149 |
| Hazard_Codes: | F+:Highlyflammable;C:Corrosive; |
|---|---|
| Symbol: | Danger |
| Packing_Group: | I |
| Hazard_Class: | 3 |
| Warning_Statement: | P210-P280-P305 + P351 + P338-P310 |
| HS_Code: | 29211980 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US) |
| Risk_Statements(EU): | R12;R20/22;R34 |
| Safety_Statements: | S3-S16-S26-S36-S45-S2733/2734/2735-STranport |
| RIDADR: | UN 2733 3/PG 2 |
| WGK_Germany: | 1 |