![Dibenzo[b,d]furan-4-carbaldehyde (CAS: 96706-46-6) - Chemical Structure and Molecular Formula](/static/img/prod-pic/FT-0683960.gif "Dibenzo[b,d]furan-4-carbaldehyde chemical structure")
Dibenzo[b,d]furan-4-carbaldehyde
Catalog No: FT-0683960
CAS No: 96706-46-6
- Chemical Name: Dibenzo[b,d]furan-4-carbaldehyde
- Molecular Formula: C13H8O2
- Molecular Weight: 196.2
- InChI Key: GQYTWBPRZFRASB-UHFFFAOYSA-N
- InChI: InChI=1S/C13H8O2/c14-8-9-4-3-6-11-10-5-1-2-7-12(10)15-13(9)11/h1-8H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Dibenzo[b,d]furan-4-carbaldehyde |
|---|---|
| Bolling_Point: | 360.5±15.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| MF: | C13H8O2 |
| CAS: | 96706-46-6 |
| Melting_Point: | 94-98ºC(lit.) |
| Flash_Point: | 170.2±13.1 °C |
| FW: | 196.201 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
|---|---|
| Exact_Mass: | 196.052429 |
| Refractive_Index: | 1.734 |
| LogP: | 3.54 |
| Bolling_Point: | 360.5±15.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| MF: | C13H8O2 |
| PSA: | 30.21000 |
| FW: | 196.201 |
| Flash_Point: | 170.2±13.1 °C |
| Melting_Point: | 94-98ºC(lit.) |
| WGK_Germany: | 3 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Safety_Statements: | 22-24/25 |
| HS_Code: | 2932999099 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)