3-Bromo-5-(dihydroxyboryl)benzoic acid
Catalog No: FT-0687824
CAS No: 913835-73-1
- Molecular Formula: 244.84
- Formula Weight: C7H6BBrO4
- Inchl Key: CWBLIPMCDMSOFX-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H6BBrO4/c9-6-2-4(7(10)11)1-5(3-6)8(12)13/h1-3,12-13H,(H,10,11)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-Bromo-5-carboxyphenylboronic acid |
|---|---|
| Flash_Point: | 244.536ºC |
| Melting_Point: | 290-292ºC |
| FW: | 244.83500 |
| Density: | 1.869g/cm3 |
| CAS: | 913835-73-1 |
| Bolling_Point: | 480.728ºC at 760 mmHg |
| MF: | C7H6BBrO4 |
| Density: | 1.869g/cm3 |
|---|---|
| Flash_Point: | 244.536ºC |
| Melting_Point: | 290-292ºC |
| FW: | 244.83500 |
| PSA: | 77.76000 |
| Exact_Mass: | 243.95400 |
| MF: | C7H6BBrO4 |
| Bolling_Point: | 480.728ºC at 760 mmHg |
| Refractive_Index: | 1.641 |
| Hazard_Codes: | Xi |
|---|---|
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)