![(3R,4S,5S)-3,4-dihydroxy-5-[(1R,2S)-1,2,3-trihydroxypropyl]oxolan-2-one (CAS: 89-67-8) - Chemical Structure and Molecular Formula](/static/img/prod-pic/FT-0699777.gif "(3R,4S,5S)-3,4-dihydroxy-5-[(1R,2S)-1,2,3-trihydroxypropyl]oxolan-2-one chemical structure")
(3R,4S,5S)-3,4-dihydroxy-5-[(1R,2S)-1,2,3-trihydroxypropyl]oxolan-2-one
Catalog No: FT-0699777
CAS No: 89-67-8
- Chemical Name: (3R,4S,5S)-3,4-dihydroxy-5-[(1R,2S)-1,2,3-trihydroxypropyl]oxolan-2-one
- Molecular Formula: C7H12O7
- Molecular Weight: 208.17
- InChI Key: VIVCRCODGMFTFY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H12O7/c8-1-2(9)3(10)6-4(11)5(12)7(13)14-6/h2-6,8-12H,1H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 152-155ºC(lit.) |
|---|---|
| FW: | 208.16600 |
| CAS: | 89-67-8 |
| MF: | C7H12O7 |
| Flash_Point: | 192.1ºC |
| Product_Name: | 3,4-dihydroxy-5-(1,2,3-trihydroxypropyl)oxolan-2-one |
| Bolling_Point: | 461ºC at 760 mmHg |
| Density: | 1.61g/cm3 |
| Melting_Point: | 152-155ºC(lit.) |
|---|---|
| FW: | 208.16600 |
| Refractive_Index: | 1.565 |
| MF: | C7H12O7 |
| Exact_Mass: | 208.05800 |
| Bolling_Point: | 461ºC at 760 mmHg |
| Density: | 1.61g/cm3 |
| PSA: | 127.45000 |
| Flash_Point: | 192.1ºC |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
