Butocarboxim
Catalog No: FT-0664005
CAS No: 34681-10-2
- Chemical Name: Butocarboxim
- Molecular Formula: C7H14N2O2S
- Molecular Weight: 190.27
- InChI Key: SFNPDDSJBGRXLW-UHFFFAOYSA-N
- InChI: InChI=1S/C7H14N2O2S/c1-5(6(2)12-4)9-11-7(10)8-3/h6H,1-4H3,(H,8,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS02, GHS06, GHS09 |
|---|---|
| CAS: | 34681-10-2 |
| Flash_Point: | N/A |
| Product_Name: | Butocarboxim |
| Bolling_Point: | N/A |
| FW: | 190.263 |
| Melting_Point: | N/A |
| MF: | C7H14N2O2S |
| Density: | 1.1±0.1 g/cm3 |
| Refractive_Index: | 1.505 |
|---|---|
| MF: | C7H14N2O2S |
| Exact_Mass: | 190.077591 |
| LogP: | 1.49 |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 190.263 |
| PSA: | 75.99000 |
| Molecular_Structure: | ['1 . Molar refractive index 5022 ', '2 . Molar volume 1694 ', '3 . Parachor (902K)4084 ', '4 . Surface tension 337 ', '5 . Dielectric constant (F/m) ', '6 偶极距(D) ', '7 . Polarizability 1990'] |
| Symbol: | GHS02, GHS06, GHS09 |
|---|---|
| RIDADR: | UN 2757 |
| HS_Code: | 2930909051 |
| Packing_Group: | III |
| Hazard_Class: | 6.1(b) |
| Risk_Statements(EU): | 10-23/24/25-36-50/53 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| RTECS: | EL9215000 |
| Hazard_Codes: | T: Toxic;N: Dangerous for the environment; |
| Warning_Statement: | P261-P273-P280-P301 + P310-P305 + P351 + P338-P311 |
| Safety_Statements: | H226-H301-H311-H319-H331-H410 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)