2,4-dimethoxybenzylamine
Catalog No: FT-0602127
CAS No: 20781-20-8
- Chemical Name: 2,4-dimethoxybenzylamine
- Molecular Formula: C9H13NO2
- Molecular Weight: 167.2
- InChI Key: QOWBXWFYRXSBAS-UHFFFAOYSA-N
- InChI: InChI=1S/C9H13NO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,6,10H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,4-Dimethoxybenzylamine |
|---|---|
| Bolling_Point: | 272.4±25.0 °C at 760 mmHg |
| MF: | C9H13NO2 |
| Symbol: | GHS05 |
| Melting_Point: | N/A |
| CAS: | 20781-20-8 |
| Density: | 1.1±0.1 g/cm3 |
| FW: | 167.205 |
| Flash_Point: | 128.4±30.4 °C |
| MF: | C9H13NO2 |
|---|---|
| Bolling_Point: | 272.4±25.0 °C at 760 mmHg |
| Exact_Mass: | 167.094635 |
| More_Info: | ['1. Appearance Colourless Liquid ', '2. Density(g/mL,25/4℃)1113 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)95 ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive index1549 ', '8. Flash point(ºC)>230 ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| PSA: | 44.48000 |
| Flash_Point: | 128.4±30.4 °C |
| Refractive_Index: | 1.523 |
| Density: | 1.1±0.1 g/cm3 |
| Molecular_Structure: | ['1 . Molar refractive index 4806 ', '2 . Molar volume (m3/mol)1574 ', '3 . Parachor (902K)3864 ', '4 表面张力(dyne/cm)363 ', '5 . Polarizability (10-24cm3)1905'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :3 ', '5. Isotope Atom Count :N/A ', '6. TPSA 445 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :130 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| FW: | 167.205 |
| LogP: | 0.97 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Risk_Statements(EU): | R34 |
|---|---|
| Hazard_Codes: | C:Corrosive; |
| RTECS: | DP4430000 |
| HS_Code: | 2922299090 |
| Packing_Group: | III |
| WGK_Germany: | 3 |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314 |
| Symbol: | GHS05 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Class: | 8 |
| RIDADR: | UN 2735 8/PG 3 |