3-Amino-5-bromopyridin-4-ol
Catalog No: FT-0687840
CAS No: 101084-20-2
- Molecular Formula: 189.01
- Formula Weight: C5H5BrN2O
- Inchl Key: DMZVRJHJGBNINH-UHFFFAOYSA-N
- Inchl: InChI=1S/C5H5BrN2O/c6-3-1-8-2-4(7)5(3)9/h1-2H,7H2,(H,8,9)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 189.010 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 101084-20-2 |
| Bolling_Point: | 434.6±45.0 °C at 760 mmHg |
| Product_Name: | 3-Amino-5-bromo-4-pyridinol |
| Melting_Point: | N/A |
| Flash_Point: | 216.7±28.7 °C |
| MF: | C5H5BrN2O |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | -0.17 |
| Flash_Point: | 216.7±28.7 °C |
| Refractive_Index: | 1.692 |
| FW: | 189.010 |
| PSA: | 59.14000 |
| MF: | C5H5BrN2O |
| Bolling_Point: | 434.6±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Exact_Mass: | 187.958511 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933399090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)