D-GLUCURONIC ACID
Catalog No: FT-0624566
CAS No: 6556-12-3
- Chemical Name: D-GLUCURONIC ACID
- Molecular Formula: C6H10O7
- Molecular Weight: 194.14
- InChI Key: IAJILQKETJEXLJ-QTBDOELSSA-N
- InChI: InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h1-5,8-11H,(H,12,13)/t2-,3+,4-,5-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 159-161ºC(lit.) |
|---|---|
| CAS: | 6556-12-3 |
| MF: | C6H10O7 |
| Flash_Point: | 211.1±22.2 °C |
| Product_Name: | α-D-Glucopyranuronic acid |
| Density: | 2.0±0.1 g/cm3 |
| FW: | 194.139 |
| Bolling_Point: | 495.2±45.0 °C at 760 mmHg |
| Refractive_Index: | 1.685 |
|---|---|
| Vapor_Pressure: | 0.0±2.9 mmHg at 25°C |
| Flash_Point: | 211.1±22.2 °C |
| LogP: | -2.88 |
| Bolling_Point: | 495.2±45.0 °C at 760 mmHg |
| FW: | 194.139 |
| PSA: | 135.29000 |
| Melting_Point: | 159-161ºC(lit.) |
| MF: | C6H10O7 |
| Exact_Mass: | 194.042648 |
| Molecular_Structure: | ['1. Molar refractive index 3757 ', '2. Molar volume 111 ', '3. Parachor (902K)3579 ', '4. Surface tension 1079 ', '5. Dielectric constant N/A ', '6. Polarizability 1489 ', '7. Single isotope mass 194042653Da ', '8. Nominal mass 194Da ', '9. Average mass 1941394Da'] |
| Density: | 2.0±0.1 g/cm3 |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RTECS: | LZ8836600 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2918990090 |
| Safety_Statements: | 37/39-26-36 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)