4-Nitro-D-phenylalanine hydrate
Catalog No: FT-0624396
CAS No: 56613-61-7
- Molecular Formula: 210.19
- Formula Weight: C9H10N2O4
- Inchl Key: GTVVZTAFGPQSPC-MRVPVSSYSA-N
- Inchl: InChI=1S/C9H10N2O4/c10-8(9(12)13)5-6-1-3-7(4-2-6)11(14)15/h1-4,8H,5,10H2,(H,12,13)/t8-/m1/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | H-D-Phe(4-NO2)-OH.H2O |
|---|---|
| Flash_Point: | 204.2±25.9 °C |
| Melting_Point: | N/A |
| FW: | 228.202 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 56613-61-7 |
| Bolling_Point: | 414.1±35.0 °C at 760 mmHg |
| MF: | C9H12N2O5 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 0.84 |
| Flash_Point: | 204.2±25.9 °C |
| Refractive_Index: | 1.614 |
| FW: | 228.202 |
| PSA: | 109.14000 |
| MF: | C9H12N2O5 |
| Bolling_Point: | 414.1±35.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 228.074615 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R11 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922499990 |
| Safety_Statements: | S22-S24/25 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)