Articaine hydrochloride
Catalog No: FT-0621704
CAS No: 23964-57-0
- Chemical Name: Articaine hydrochloride
- Molecular Formula: C13H21ClN2O3S
- Molecular Weight: 320.84
- InChI Key: GDWDBGSWGNEMGJ-UHFFFAOYSA-N
- InChI: InChI=1S/C13H20N2O3S.ClH/c1-5-6-14-9(3)12(16)15-10-8(2)7-19-11(10)13(17)18-4;/h7,9,14H,5-6H2,1-4H3,(H,15,16);1H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 23964-57-0 |
| Flash_Point: | 220.3ºC |
| Product_Name: | Articaine hydrochloride |
| Bolling_Point: | 440.6ºC at 760 mmHg |
| FW: | 320.835 |
| Melting_Point: | N/A |
| MF: | C13H21ClN2O3S |
| Density: | 1.178 g/cm3 |
| Vapor_Pressure: | 5.79E-08mmHg at 25°C |
|---|---|
| MF: | C13H21ClN2O3S |
| Flash_Point: | 220.3ºC |
| LogP: | 3.43560 |
| FW: | 320.835 |
| Density: | 1.178 g/cm3 |
| PSA: | 95.67000 |
| Bolling_Point: | 440.6ºC at 760 mmHg |
| Exact_Mass: | 320.096130 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)