6-CHLOROBENZO[D]ISOXAZOL-3-OL
Catalog No: FT-0621064
CAS No: 61977-29-5
- Molecular Formula: 169.56
- Formula Weight: C7H4ClNO2
- Inchl Key: SJAPSPJRTQCDNO-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H4ClNO2/c8-4-1-2-5-6(3-4)11-9-7(5)10/h1-3H,(H,9,10)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 169.565 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 61977-29-5 |
| Bolling_Point: | 336.7±22.0 °C at 760 mmHg |
| Product_Name: | 6-Chlorobenzo[D]Isoxazol-3-Ol |
| Melting_Point: | 218-220ºC |
| Flash_Point: | 157.4±22.3 °C |
| MF: | C7H4ClNO2 |
| LogP: | 1.49 |
|---|---|
| Flash_Point: | 157.4±22.3 °C |
| Refractive_Index: | 1.674 |
| FW: | 169.565 |
| Bolling_Point: | 336.7±22.0 °C at 760 mmHg |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 218-220ºC |
| PSA: | 46.26000 |
| Exact_Mass: | 168.993057 |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| MF: | C7H4ClNO2 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36/37/39 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)