Methyl 5-methylsalicylate
Catalog No: FT-0620672
CAS No: 22717-57-3
- Chemical Name: Methyl 5-methylsalicylate
- Molecular Formula: C9H10O3
- Molecular Weight: 166.17
- InChI Key: JQYUQKRFSSSGJM-UHFFFAOYSA-N
- InChI: InChI=1S/C9H10O3/c1-6-3-4-8(10)7(5-6)9(11)12-2/h3-5,10H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 166.174 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 22717-57-3 |
| Bolling_Point: | 242.4±20.0 °C at 760 mmHg |
| Product_Name: | Methyl 5-Methylsalicylate |
| Melting_Point: | 2ºC |
| Flash_Point: | 98.5±14.5 °C |
| MF: | C9H10O3 |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 4473 ', '2 . Molar volume 1420 ', '3 . Parachor (902K)3647 ', '4 表面张力(dyne/cm)435 ', '5 . Polarizability (10-24cm3)1773'] |
|---|---|
| Flash_Point: | 98.5±14.5 °C |
| Refractive_Index: | 1.542 |
| FW: | 166.174 |
| Density: | 1.2±0.1 g/cm3 |
| Bolling_Point: | 242.4±20.0 °C at 760 mmHg |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :4 ', '6. TPSA 465 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :167 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| LogP: | 2.69 |
| Melting_Point: | 2ºC |
| PSA: | 46.53000 |
| MF: | C9H10O3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)1153 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)Unknow ', '5. Boiling point(ºC,Atmospheric pressure)Unknow ', '6. Boiling point(ºC,52kPa) 241-243°C767mm Hg(lit) ', '7. Refractive index 1533 ', '8. Flash point(ºC)227°F ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 166.062988 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2918290000 |
| WGK_Germany: | 2 |