2,5-DIMETHOXYTEREPHTHALALDEHYDE
Catalog No: FT-0610412
CAS No: 7310-97-6
- Chemical Name: 2,5-DIMETHOXYTEREPHTHALALDEHYDE
- Molecular Formula: C10H10O4
- Molecular Weight: 194.18
- InChI Key: YSIIHTHHMPYKFP-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10O4/c1-13-9-3-8(6-12)10(14-2)4-7(9)5-11/h3-6H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 194.18400 |
| Density: | 1.207g/cm3 |
| CAS: | 7310-97-6 |
| Bolling_Point: | 371.4ºC at 760 mmHg |
| Product_Name: | 2,5-dimethoxyterephthalaldehyde |
| Melting_Point: | 220ºC |
| Flash_Point: | 168.2ºC |
| MF: | C10H10O4 |
| Density: | 1.207g/cm3 |
|---|---|
| LogP: | 1.32880 |
| Flash_Point: | 168.2ºC |
| Melting_Point: | 220ºC |
| FW: | 194.18400 |
| PSA: | 52.60000 |
| Exact_Mass: | 194.05800 |
| MF: | C10H10O4 |
| Bolling_Point: | 371.4ºC at 760 mmHg |
| Refractive_Index: | 1.574 |
| Risk_Statements(EU): | 36/37/38 |
|---|---|
| Safety_Statements: | 26 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)