(S)-2,3-dihydro-1,4-Benzodioxin-2-methanamine
Catalog No: FT-0603871
CAS No: 46049-49-4
- Chemical Name: (S)-2,3-dihydro-1,4-Benzodioxin-2-methanamine
- Molecular Formula: C9H11NO2
- Molecular Weight: 165.19
- InChI Key: JHNURUNMNRSGRO-ZETCQYMHSA-N
- InChI: InChI=1S/C9H11NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6,10H2/t7-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 1-(2,3-Dihydro-1,4-benzodioxin-2-yl)methanamine |
|---|---|
| Flash_Point: | 124.1±28.8 °C |
| Melting_Point: | N/A |
| FW: | 165.189 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 46049-49-4 |
| Bolling_Point: | 266.0±19.0 °C at 760 mmHg |
| MF: | C9H11NO2 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 0.92 |
| Flash_Point: | 124.1±28.8 °C |
| Refractive_Index: | 1.545 |
| FW: | 165.189 |
| PSA: | 44.48000 |
| MF: | C9H11NO2 |
| Bolling_Point: | 266.0±19.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Exact_Mass: | 165.078979 |
| HS_Code: | 2932999099 |
|---|