Pentoxifylline
Catalog No: FT-0603570
CAS No: 6493-05-6
- Chemical Name: Pentoxifylline
- Molecular Formula: C13H18N4O3
- Molecular Weight: 278.31
- InChI Key: BYPFEZZEUUWMEJ-UHFFFAOYSA-N
- InChI: InChI=1S/C13H18N4O3/c1-9(18)6-4-5-7-17-12(19)10-11(14-8-15(10)2)16(3)13(17)20/h8H,4-7H2,1-3H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 531.3±56.0 °C at 760 mmHg |
|---|---|
| CAS: | 6493-05-6 |
| MF: | C13H18N4O3 |
| Melting_Point: | 98-100°C |
| Symbol: | Warning |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 278.307 |
| Product_Name: | Pentoxifylline |
| Flash_Point: | 275.1±31.8 °C |
| Bolling_Point: | 531.3±56.0 °C at 760 mmHg |
|---|---|
| Vapor_Pressure: | 0.0±1.4 mmHg at 25°C |
| LogP: | 0.32 |
| Density: | 1.3±0.1 g/cm3 |
| Melting_Point: | 98-100°C |
| Exact_Mass: | 278.137878 |
| MF: | C13H18N4O3 |
| Refractive_Index: | 1.621 |
| PSA: | 78.89000 |
| Flash_Point: | 275.1±31.8 °C |
| Molecular_Structure: | ['1. Molar refractive index 7428 ', '2. Molar volume 2112 ', '3. Parachor (902K)5632 ', '4. Surface tension 505 ', '5. Dielectric constant N/A ', '6. Polarizability 2944 ', '7. Single isotope mass 27813789Da ', '8. Nominal mass 278Da ', '9. Average mass 278307Da'] |
| FW: | 278.307 |
| Safety_Statements: | H302 |
|---|---|
| HS_Code: | 2933990090 |
| WGK_Germany: | 3 |
| Hazard_Codes: | Xn |
| RTECS: | XH2475000 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
| Symbol: | Warning |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Warning_Statement: | P301 + P312 + P330 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)