Ethyl 2-bromothiazole-4-carboxylate
Catalog No: FT-0601911
CAS No: 100367-77-9
- Chemical Name: Ethyl 2-bromothiazole-4-carboxylate
- Molecular Formula: C6H6BrNO2S
- Molecular Weight: 236.09
- InChI Key: CNHISCQPKKGDPO-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6BrNO2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 48-52ºC |
|---|---|
| CAS: | 100367-77-9 |
| MF: | C6H6BrNO2S |
| Flash_Point: | 121.7±19.8 °C |
| Product_Name: | Ethyl 2-bromothiazole-4-carboxylate |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 236.086 |
| Bolling_Point: | 277.6±13.0 °C at 760 mmHg |
| Melting_Point: | 48-52ºC |
|---|---|
| Refractive_Index: | 1.570 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C6H6BrNO2S |
| Flash_Point: | 121.7±19.8 °C |
| LogP: | 2.44 |
| FW: | 236.086 |
| Density: | 1.7±0.1 g/cm3 |
| PSA: | 67.43000 |
| Bolling_Point: | 277.6±13.0 °C at 760 mmHg |
| Exact_Mass: | 234.930252 |
| Risk_Statements(EU): | 36/37/38 |
|---|---|
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| HS_Code: | 2934100090 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)