Diethyl aminomalonate
Catalog No: FT-0601119
CAS No: 6829-40-9
- Chemical Name: Diethyl aminomalonate
- Molecular Formula: C7H13NO4
- Molecular Weight: 175.18
- InChI Key: WLTCKEHCTUYJGI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H13NO4/c1-3-11-6(9)5(8)7(10)12-4-2/h5H,3-4,8H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 88ºC |
|---|---|
| CAS: | 6829-40-9 |
| MF: | C7H13NO4 |
| Flash_Point: | 52.3ºC |
| Product_Name: | Diethyl 2-aminomalonate |
| Density: | 1.129 g/cm3 |
| FW: | 175.18200 |
| Bolling_Point: | 122-123ºC(2.13kPa),52.3ºC |
| Melting_Point: | 88ºC |
|---|---|
| MF: | C7H13NO4 |
| Flash_Point: | 52.3ºC |
| LogP: | 0.14020 |
| FW: | 175.18200 |
| Density: | 1.129 g/cm3 |
| PSA: | 78.62000 |
| Bolling_Point: | 122-123ºC(2.13kPa),52.3ºC |
| Computational_Chemistry: | ['1. XlogP :01 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :6 ', '5. Isotope Atom Count :N/A ', '6. TPSA :786 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :151 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Exact_Mass: | 175.08400 |
| HS_Code: | 2922499990 |
|---|