3-Bromo-5-methylpyridine
Catalog No: FT-0600607
CAS No: 3430-16-8
- Chemical Name: 3-Bromo-5-methylpyridine
- Molecular Formula: C6H6BrN
- Molecular Weight: 172.02
- InChI Key: ADCLTLQMVAEBLB-UHFFFAOYSA-N
- InChI: InChI=1S/C6H6BrN/c1-5-2-6(7)4-8-3-5/h2-4H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 172.023 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 3430-16-8 |
| Bolling_Point: | 197.4±20.0 °C at 760 mmHg |
| Product_Name: | 5-Bromo-3-picoline |
| Melting_Point: | N/A |
| Flash_Point: | 73.2±21.8 °C |
| MF: | C6H6BrN |
| Density: | 1.5±0.1 g/cm3 |
|---|---|
| LogP: | 2.21 |
| Flash_Point: | 73.2±21.8 °C |
| Refractive_Index: | 1.553 |
| FW: | 172.023 |
| PSA: | 12.89000 |
| MF: | C6H6BrN |
| Bolling_Point: | 197.4±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.5±0.4 mmHg at 25°C |
| Exact_Mass: | 170.968353 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Hazard_Codes: | Xn:Harmful |
| Risk_Statements(EU): | R22;R41 |
| Safety_Statements: | S26-S39 |
| Symbol: | Danger |
| Warning_Statement: | P280-P305 + P351 + P338 |
| RIDADR: | NA 1993 / PGIII |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)